C18H12F5N3O — CID 134291218
5-fluoro-2-(2-fluoro-3-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 134291218) has the molecular formula C18H12F5N3O and a molecular weight of 381.30 g/mol. Its IUPAC name is 5-fluoro-2-(2-fluoro-3-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 5-fluoro-2-(2-fluoro-3-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134291218 |
| Molecular Formula | C18H12F5N3O |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 5-fluoro-2-(2-fluoro-3-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | Cc1cccc(Nc2nc(=O)c(F)cn2Cc2cc(F)c(F)c(F)c2)c1F |
| InChI | InChI=1S/C18H12F5N3O/c1-9-3-2-4-14(15(9)22)24-18-25-17(27)13(21)8-26(18)7-10-5-11(19)16(23)12(20)6-10/h2-6,8H,7H2,1H3,(H,24,25,27) |
| InChIKey | NOYRMLXMUIZBLB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|