C20H18F4N4O — CID 134291236
2-[4-(dimethylamino)-2-methylanilino]-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 134291236) has the molecular formula C20H18F4N4O and a molecular weight of 406.38 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-2-methylanilino]-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 2-[4-(dimethylamino)-2-methylanilino]-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134291236 |
| Molecular Formula | C20H18F4N4O |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[4-(dimethylamino)-2-methylanilino]-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | Cc1cc(N(C)C)ccc1Nc1nc(=O)c(F)cn1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C20H18F4N4O/c1-11-6-13(27(2)3)4-5-17(11)25-20-26-19(29)16(23)10-28(20)9-12-7-14(21)18(24)15(22)8-12/h4-8,10H,9H2,1-3H3,(H,25,26,29) |
| InChIKey | QXEIYXHMLQFTMC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|