C18H16F3N5O2 — CID 134291270
3-[(6-methoxy-2-methyl-3-pyridinyl)amino]-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one (PubChem CID 134291270) has the molecular formula C18H16F3N5O2 and a molecular weight of 391.35 g/mol. Its IUPAC name is 3-[(6-methoxy-2-methyl-3-pyridinyl)amino]-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one.
| Compound Name | 3-[(6-methoxy-2-methyl-3-pyridinyl)amino]-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 134291270 |
| Molecular Formula | C18H16F3N5O2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 3-[(6-methoxy-2-methyl-3-pyridinyl)amino]-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
| SMILES | COc1ccc(Nc2nc(=O)c(C)nn2Cc2cc(F)c(F)c(F)c2)c(C)n1 |
| InChI | InChI=1S/C18H16F3N5O2/c1-9-14(4-5-15(22-9)28-3)23-18-24-17(27)10(2)25-26(18)8-11-6-12(19)16(21)13(20)7-11/h4-7H,8H2,1-3H3,(H,23,24,27) |
| InChIKey | WUKUBCGSRPZBGS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|