C19H16F4N4O3 — CID 134291275
3-(2-fluoro-4,5-dimethoxyanilino)-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one (PubChem CID 134291275) has the molecular formula C19H16F4N4O3 and a molecular weight of 424.35 g/mol. Its IUPAC name is 3-(2-fluoro-4,5-dimethoxyanilino)-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one.
| Compound Name | 3-(2-fluoro-4,5-dimethoxyanilino)-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 134291275 |
| Molecular Formula | C19H16F4N4O3 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 3-(2-fluoro-4,5-dimethoxyanilino)-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
| SMILES | COc1cc(F)c(Nc2nc(=O)c(C)nn2Cc2cc(F)c(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C19H16F4N4O3/c1-9-18(28)25-19(24-14-7-16(30-3)15(29-2)6-11(14)20)27(26-9)8-10-4-12(21)17(23)13(22)5-10/h4-7H,8H2,1-3H3,(H,24,25,28) |
| InChIKey | SSARGCNOQPQLQP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|