C20H19F3N4O3 — CID 134291323
3-(4,5-dimethoxy-2-methylanilino)-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one (PubChem CID 134291323) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-2-methylanilino)-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one.
| Compound Name | 3-(4,5-dimethoxy-2-methylanilino)-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 134291323 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-(4,5-dimethoxy-2-methylanilino)-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
| SMILES | COc1cc(C)c(Nc2nc(=O)c(C)nn2Cc2cc(F)c(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C20H19F3N4O3/c1-10-5-16(29-3)17(30-4)8-15(10)24-20-25-19(28)11(2)26-27(20)9-12-6-13(21)18(23)14(22)7-12/h5-8H,9H2,1-4H3,(H,24,25,28) |
| InChIKey | FMSHJTDFHPZYQN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|