C30H46F2N2O2 — CID 134291682
(3Z)-5-(cyclohepta-1,3,5-trien-1-ylmethoxy)-N-[2-(dimethylamino)-5,5-difluoro-2-methylhexyl]-4-ethyl-2-(3-methylbutylidene)hexa-3,5-dienamide (PubChem CID 134291682) has the molecular formula C30H46F2N2O2 and a molecular weight of 504.71 g/mol. Its IUPAC name is (3Z)-5-(cyclohepta-1,3,5-trien-1-ylmethoxy)-N-[2-(dimethylamino)-5,5-difluoro-2-methylhexyl]-4-ethyl-2-(3-methylbutylidene)hexa-3,5-dienamide.
| Compound Name | (3Z)-5-(cyclohepta-1,3,5-trien-1-ylmethoxy)-N-[2-(dimethylamino)-5,5-difluoro-2-methylhexyl]-4-ethyl-2-(3-methylbutylidene)hexa-3,5-dienamide |
|---|---|
| PubChem CID | 134291682 |
| Molecular Formula | C30H46F2N2O2 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | (3Z)-5-(cyclohepta-1,3,5-trien-1-ylmethoxy)-N-[2-(dimethylamino)-5,5-difluoro-2-methylhexyl]-4-ethyl-2-(3-methylbutylidene)hexa-3,5-dienamide |
| SMILES | C=C(OCC1=CC=CC=CC1)/C(=C\C(=CCC(C)C)C(=O)NCC(C)(CCC(C)(F)F)N(C)C)CC |
| InChI | InChI=1S/C30H46F2N2O2/c1-9-26(24(4)36-21-25-14-12-10-11-13-15-25)20-27(17-16-23(2)3)28(35)33-22-29(5,34(7)8)18-19-30(6,31)32/h10-14,17,20,23H,4,9,15-16,18-19,21-22H2,1-3,5-8H3,(H,33,35)/b26-20-,27-17? |
| InChIKey | WJOSMSGYLSEUBV-DYHMXQEXSA-N |
| XLogP | 7.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|