About (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid
(5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 134291884) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid |
| PubChem CID | 134291884 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | COC1=C(O)[C@@](C)(OC)CC(C(=O)O)=C1 |
| InChI | InChI=1S/C10H14O5/c1-10(15-3)5-6(9(12)13)4-7(14-2)8(10)11/h4,11H,5H2,1-3H3,(H,12,13)/t10-/m0/s1 |
| InChIKey | RISFEVROLYWAGW-JTQLQIEISA-N |
| XLogP | 1.22 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid (CID 134291884) is (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid is COC1=C(O)[C@@](C)(OC)CC(C(=O)O)=C1.
What is the InChIKey of (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is RISFEVROLYWAGW-JTQLQIEISA-N. The full InChI is InChI=1S/C10H14O5/c1-10(15-3)5-6(9(12)13)4-7(14-2)8(10)11/h4,11H,5H2,1-3H3,(H,12,13)/t10-/m0/s1.
What are the key properties of (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid?
(5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 214.22 g/mol, XLogP of 1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-4-hydroxy-3,5-dimethoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 134291884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).