C31H33NO4 — CID 134291941
1-[4-cyclopentyl-5,5-bis(4-hydroxyphenyl)pent-4-enyl]-3-ethenyl-4-[(Z)-prop-1-enyl]pyrrole-2,5-dione (PubChem CID 134291941) has the molecular formula C31H33NO4 and a molecular weight of 483.61 g/mol. Its IUPAC name is 1-[4-cyclopentyl-5,5-bis(4-hydroxyphenyl)pent-4-enyl]-3-ethenyl-4-[(Z)-prop-1-enyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-cyclopentyl-5,5-bis(4-hydroxyphenyl)pent-4-enyl]-3-ethenyl-4-[(Z)-prop-1-enyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 134291941 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 1-[4-cyclopentyl-5,5-bis(4-hydroxyphenyl)pent-4-enyl]-3-ethenyl-4-[(Z)-prop-1-enyl]pyrrole-2,5-dione |
| SMILES | C=CC1=C(/C=C\C)C(=O)N(CCCC(=C(c2ccc(O)cc2)c2ccc(O)cc2)C2CCCC2)C1=O |
| InChI | InChI=1S/C31H33NO4/c1-3-8-28-26(4-2)30(35)32(31(28)36)20-7-11-27(21-9-5-6-10-21)29(22-12-16-24(33)17-13-22)23-14-18-25(34)19-15-23/h3-4,8,12-19,21,33-34H,2,5-7,9-11,20H2,1H3/b8-3- |
| InChIKey | NWFYNPVCGQIUIZ-BAQGIRSFSA-N |
| XLogP | 6.30 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|