C30H27ClF6N4O2 — CID 134291964
3-[1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl]-N-[(2E,4E)-2-methyl-5-(trifluoromethoxy)hexa-2,4-dienyl]benzamide (PubChem CID 134291964) has the molecular formula C30H27ClF6N4O2 and a molecular weight of 625.01 g/mol. Its IUPAC name is 3-[1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl]-N-[(2E,4E)-2-methyl-5-(trifluoromethoxy)hexa-2,4-dienyl]benzamide.
| Compound Name | 3-[1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl]-N-[(2E,4E)-2-methyl-5-(trifluoromethoxy)hexa-2,4-dienyl]benzamide |
|---|---|
| PubChem CID | 134291964 |
| Molecular Formula | C30H27ClF6N4O2 |
| Molecular Weight | 625.01 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | 3-[1-[[5-chloro-2-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-7-yl]-N-[(2E,4E)-2-methyl-5-(trifluoromethoxy)hexa-2,4-dienyl]benzamide |
| SMILES | C/C(=C\C=C(/C)OC(F)(F)F)CNC(=O)c1cccc(-c2cnc3c(c2)N(Cc2cc(Cl)ccc2C(F)(F)F)CCN3)c1 |
| InChI | InChI=1S/C30H27ClF6N4O2/c1-18(6-7-19(2)43-30(35,36)37)15-40-28(42)21-5-3-4-20(12-21)22-14-26-27(39-16-22)38-10-11-41(26)17-23-13-24(31)8-9-25(23)29(32,33)34/h3-9,12-14,16H,10-11,15,17H2,1-2H3,(H,38,39)(H,40,42)/b18-6+,19-7+ |
| InChIKey | NGWIXFUNFXGMLK-JRGWAENISA-N |
| XLogP | 7.97 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.01 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|