C25H30Cl2N6 — CID 134291981
1-[(2,5-dichlorophenyl)methyl]-6-methyl-7-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-3,4,5,6-tetrahydro-2H-pyrido[2,3-b]pyrazine (PubChem CID 134291981) has the molecular formula C25H30Cl2N6 and a molecular weight of 485.46 g/mol. Its IUPAC name is 1-[(2,5-dichlorophenyl)methyl]-6-methyl-7-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-3,4,5,6-tetrahydro-2H-pyrido[2,3-b]pyrazine.
| Compound Name | 1-[(2,5-dichlorophenyl)methyl]-6-methyl-7-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-3,4,5,6-tetrahydro-2H-pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 134291981 |
| Molecular Formula | C25H30Cl2N6 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 1-[(2,5-dichlorophenyl)methyl]-6-methyl-7-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-3,4,5,6-tetrahydro-2H-pyrido[2,3-b]pyrazine |
| SMILES | CC1NC2=C(C=C1c1ccc(N3CCN(C)CC3)nc1)N(Cc1cc(Cl)ccc1Cl)CCN2 |
| InChI | InChI=1S/C25H30Cl2N6/c1-17-21(18-3-6-24(29-15-18)32-11-9-31(2)10-12-32)14-23-25(30-17)28-7-8-33(23)16-19-13-20(26)4-5-22(19)27/h3-6,13-15,17,28,30H,7-12,16H2,1-2H3 |
| InChIKey | ORQBEGGDUVQJMI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |