C18H28FN3 — CID 134292061
4-[[5-[(2Z,4E)-6-fluoro-5-methylhepta-2,4-dien-4-yl]imidazol-1-yl]methyl]-1-methylpiperidine (PubChem CID 134292061) has the molecular formula C18H28FN3 and a molecular weight of 305.44 g/mol. Its IUPAC name is 4-[[5-[(2Z,4E)-6-fluoro-5-methylhepta-2,4-dien-4-yl]imidazol-1-yl]methyl]-1-methylpiperidine.
| Compound Name | 4-[[5-[(2Z,4E)-6-fluoro-5-methylhepta-2,4-dien-4-yl]imidazol-1-yl]methyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 134292061 |
| Molecular Formula | C18H28FN3 |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | 4-[[5-[(2Z,4E)-6-fluoro-5-methylhepta-2,4-dien-4-yl]imidazol-1-yl]methyl]-1-methylpiperidine |
| SMILES | C/C=C\C(=C(\C)C(C)F)c1cncn1CC1CCN(C)CC1 |
| InChI | InChI=1S/C18H28FN3/c1-5-6-17(14(2)15(3)19)18-11-20-13-22(18)12-16-7-9-21(4)10-8-16/h5-6,11,13,15-16H,7-10,12H2,1-4H3/b6-5-,17-14+ |
| InChIKey | KSZDPPFFOKAFMI-QEVQMFJRSA-N |
| XLogP | 3.93 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|