C74H95N7S — CID 134292115
4,7-bis[4-[4-(2-methylhexan-2-yl)-N-[4-(2-methylhexan-2-yl)phenyl]anilino]phenyl]-2-(2-methylpropyl)-6-thionitrosobenzotriazol-5-amine (PubChem CID 134292115) has the molecular formula C74H95N7S and a molecular weight of 1114.69 g/mol. Its IUPAC name is 4,7-bis[4-[4-(2-methylhexan-2-yl)-N-[4-(2-methylhexan-2-yl)phenyl]anilino]phenyl]-2-(2-methylpropyl)-6-thionitrosobenzotriazol-5-amine.
| Compound Name | 4,7-bis[4-[4-(2-methylhexan-2-yl)-N-[4-(2-methylhexan-2-yl)phenyl]anilino]phenyl]-2-(2-methylpropyl)-6-thionitrosobenzotriazol-5-amine |
|---|---|
| PubChem CID | 134292115 |
| Molecular Formula | C74H95N7S |
| Molecular Weight | 1114.69 g/mol |
| Exact Mass | 1113.74 |
| IUPAC Name | 4,7-bis[4-[4-(2-methylhexan-2-yl)-N-[4-(2-methylhexan-2-yl)phenyl]anilino]phenyl]-2-(2-methylpropyl)-6-thionitrosobenzotriazol-5-amine |
| SMILES | CCCCC(C)(C)c1ccc(N(c2ccc(-c3c(N)c(N=S)c(-c4ccc(N(c5ccc(C(C)(C)CCCC)cc5)c5ccc(C(C)(C)CCCC)cc5)cc4)c4nn(CC(C)C)nc34)cc2)c2ccc(C(C)(C)CCCC)cc2)cc1 |
| InChI | InChI=1S/C74H95N7S/c1-15-19-47-71(7,8)55-27-39-61(40-28-55)80(62-41-29-56(30-42-62)72(9,10)48-20-16-2)59-35-23-53(24-36-59)65-67(75)68(78-82)66(70-69(65)76-79(77-70)51-52(5)6)54-25-37-60(38-26-54)81(63-43-31-57(32-44-63)73(11,12)49-21-17-3)64-45-33-58(34-46-64)74(13,14)50-22-18-4/h23-46,52H,15-22,47-51,75H2,1-14H3 |
| InChIKey | NYMLVJCTZZZLIP-UHFFFAOYSA-N |
| XLogP | 22.18 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1114.69 |
| LogP ≤ 5 | 22.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|