About (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine
(1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine (PubChem CID 134292233) has the molecular formula C11H20ClN3
and a molecular weight of 229.75 g/mol. Its IUPAC name is (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine |
| PubChem CID | 134292233 |
| Molecular Formula | C11H20ClN3 |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine |
| SMILES | C/C=C\N(N)C(C)/C(Cl)=C\C(=C/N)CC |
| InChI | InChI=1S/C11H20ClN3/c1-4-6-15(14)9(3)11(12)7-10(5-2)8-13/h4,6-9H,5,13-14H2,1-3H3/b6-4-,10-8-,11-7+ |
| InChIKey | SXKGYMCUPQGWTN-BAQMHCSOSA-N |
| XLogP | 2.46 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine?
The IUPAC name of (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine (CID 134292233) is (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine.
What is the SMILES notation for (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine?
The canonical SMILES for (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine is C/C=C\N(N)C(C)/C(Cl)=C\C(=C/N)CC.
What is the InChIKey of (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine?
The InChIKey is SXKGYMCUPQGWTN-BAQMHCSOSA-N. The full InChI is InChI=1S/C11H20ClN3/c1-4-6-15(14)9(3)11(12)7-10(5-2)8-13/h4,6-9H,5,13-14H2,1-3H3/b6-4-,10-8-,11-7+.
What are the key properties of (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine?
(1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine has a molecular weight of 229.75 g/mol, XLogP of 2.46, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3E)-5-[amino-[(Z)-prop-1-enyl]amino]-4-chloro-2-ethylhexa-1,3-dien-1-amine is sourced from PubChem (CID 134292233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).