About 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde
8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde (PubChem CID 134292285) has the molecular formula C10H11ClN2O
and a molecular weight of 210.66 g/mol. Its IUPAC name is 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde.
Molecular Properties
| Compound Name | 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde |
| PubChem CID | 134292285 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde |
| SMILES | CN1CCNc2cc(C=O)cc(Cl)c21 |
| InChI | InChI=1S/C10H11ClN2O/c1-13-3-2-12-9-5-7(6-14)4-8(11)10(9)13/h4-6,12H,2-3H2,1H3 |
| InChIKey | HRWRWTUCPHPAPH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde?
The IUPAC name of 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde (CID 134292285) is 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde.
What is the SMILES notation for 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde?
The canonical SMILES for 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde is CN1CCNc2cc(C=O)cc(Cl)c21.
What is the InChIKey of 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde?
The InChIKey is HRWRWTUCPHPAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2O/c1-13-3-2-12-9-5-7(6-14)4-8(11)10(9)13/h4-6,12H,2-3H2,1H3.
What are the key properties of 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde?
8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde has a molecular weight of 210.66 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1-methyl-3,4-dihydro-2H-quinoxaline-6-carbaldehyde is sourced from PubChem (CID 134292285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).