C12H16N2 — CID 134292333
6-ethenyl-1,3,8-trimethyl-8aH-imidazo[1,2-a]pyridine (PubChem CID 134292333) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 6-ethenyl-1,3,8-trimethyl-8aH-imidazo[1,2-a]pyridine.
| Compound Name | 6-ethenyl-1,3,8-trimethyl-8aH-imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 134292333 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 6-ethenyl-1,3,8-trimethyl-8aH-imidazo[1,2-a]pyridine |
| SMILES | C=CC1=CN2C(C)=CN(C)C2C(C)=C1 |
| InChI | InChI=1S/C12H16N2/c1-5-11-6-9(2)12-13(4)7-10(3)14(12)8-11/h5-8,12H,1H2,2-4H3 |
| InChIKey | BZPQKCRESOJDCX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |