C31H34F2O6 — CID 134292412
ethyl 2-[(2R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2,2-difluoroacetate (PubChem CID 134292412) has the molecular formula C31H34F2O6 and a molecular weight of 540.60 g/mol. Its IUPAC name is ethyl 2-[(2R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[(2R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 134292412 |
| Molecular Formula | C31H34F2O6 |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | ethyl 2-[(2R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)[C@H]1C[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C31H34F2O6/c1-2-36-30(34)31(32,33)28-18-26(37-20-24-14-8-4-9-15-24)29(38-21-25-16-10-5-11-17-25)27(39-28)22-35-19-23-12-6-3-7-13-23/h3-17,26-29H,2,18-22H2,1H3/t26-,27-,28-,29-/m1/s1 |
| InChIKey | JDOABJYZWWRNQH-CXDXLJMYSA-N |
| XLogP | 5.73 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |