C27H36FNO — CID 134292923
N-[(E)-3-ethyl-5-methylhept-3-en-2-yl]oxy-3-[(E)-2-(4-fluorophenyl)prop-1-enyl]-4-methylcyclohepta-1,3,6-trien-1-amine (PubChem CID 134292923) has the molecular formula C27H36FNO and a molecular weight of 409.59 g/mol. Its IUPAC name is N-[(E)-3-ethyl-5-methylhept-3-en-2-yl]oxy-3-[(E)-2-(4-fluorophenyl)prop-1-enyl]-4-methylcyclohepta-1,3,6-trien-1-amine.
| Compound Name | N-[(E)-3-ethyl-5-methylhept-3-en-2-yl]oxy-3-[(E)-2-(4-fluorophenyl)prop-1-enyl]-4-methylcyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 134292923 |
| Molecular Formula | C27H36FNO |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | N-[(E)-3-ethyl-5-methylhept-3-en-2-yl]oxy-3-[(E)-2-(4-fluorophenyl)prop-1-enyl]-4-methylcyclohepta-1,3,6-trien-1-amine |
| SMILES | CC/C(=C\C(C)CC)C(C)ONC1=CC(/C=C(\C)c2ccc(F)cc2)=C(C)CC=C1 |
| InChI | InChI=1S/C27H36FNO/c1-7-19(3)16-23(8-2)22(6)30-29-27-11-9-10-20(4)25(18-27)17-21(5)24-12-14-26(28)15-13-24/h9,11-19,22,29H,7-8,10H2,1-6H3/b21-17+,23-16+ |
| InChIKey | HTUWNGUICCDPRG-XOMTYMKISA-N |
| XLogP | 7.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|