About 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one
4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one (PubChem CID 13429345) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one.
Molecular Properties
| Compound Name | 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one |
| PubChem CID | 13429345 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one |
| SMILES | CC1COC2CC(=O)CC1O2 |
| InChI | InChI=1S/C8H12O3/c1-5-4-10-8-3-6(9)2-7(5)11-8/h5,7-8H,2-4H2,1H3 |
| InChIKey | DXUVEDKKCVVSCC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one?
The IUPAC name of 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one (CID 13429345) is 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one.
What is the SMILES notation for 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one?
The canonical SMILES for 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one is CC1COC2CC(=O)CC1O2.
What is the InChIKey of 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one?
The InChIKey is DXUVEDKKCVVSCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-5-4-10-8-3-6(9)2-7(5)11-8/h5,7-8H,2-4H2,1H3.
What are the key properties of 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one?
4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one has a molecular weight of 156.18 g/mol, XLogP of 0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,9-dioxabicyclo[3.3.1]nonan-7-one is sourced from PubChem (CID 13429345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).