C25H36S — CID 134293651
1-ethynyl-1-[(2E)-5-methyl-1-[(3Z,5Z)-4-propan-2-ylhepta-1,3,5-trien-2-yl]sulfanylhexa-2,4-dien-3-yl]cyclohexane (PubChem CID 134293651) has the molecular formula C25H36S and a molecular weight of 368.63 g/mol. Its IUPAC name is 1-ethynyl-1-[(2E)-5-methyl-1-[(3Z,5Z)-4-propan-2-ylhepta-1,3,5-trien-2-yl]sulfanylhexa-2,4-dien-3-yl]cyclohexane.
| Compound Name | 1-ethynyl-1-[(2E)-5-methyl-1-[(3Z,5Z)-4-propan-2-ylhepta-1,3,5-trien-2-yl]sulfanylhexa-2,4-dien-3-yl]cyclohexane |
|---|---|
| PubChem CID | 134293651 |
| Molecular Formula | C25H36S |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-ethynyl-1-[(2E)-5-methyl-1-[(3Z,5Z)-4-propan-2-ylhepta-1,3,5-trien-2-yl]sulfanylhexa-2,4-dien-3-yl]cyclohexane |
| SMILES | C#CC1(/C(C=C(C)C)=C/CSC(=C)/C=C(\C=C/C)C(C)C)CCCCC1 |
| InChI | InChI=1S/C25H36S/c1-8-13-23(21(5)6)19-22(7)26-17-14-24(18-20(3)4)25(9-2)15-11-10-12-16-25/h2,8,13-14,18-19,21H,7,10-12,15-17H2,1,3-6H3/b13-8-,23-19+,24-14+ |
| InChIKey | QNSHYKBZVDSDDW-VQPTVJRDSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|