C17H19N5S — CID 134293686
2-[[4-(1-methylsulfanylpiperidin-4-yl)-2-pyridinyl]amino]pyridine-4-carbonitrile (PubChem CID 134293686) has the molecular formula C17H19N5S and a molecular weight of 325.44 g/mol. Its IUPAC name is 2-[[4-(1-methylsulfanylpiperidin-4-yl)-2-pyridinyl]amino]pyridine-4-carbonitrile.
| Compound Name | 2-[[4-(1-methylsulfanylpiperidin-4-yl)-2-pyridinyl]amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 134293686 |
| Molecular Formula | C17H19N5S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[[4-(1-methylsulfanylpiperidin-4-yl)-2-pyridinyl]amino]pyridine-4-carbonitrile |
| SMILES | CSN1CCC(c2ccnc(Nc3cc(C#N)ccn3)c2)CC1 |
| InChI | InChI=1S/C17H19N5S/c1-23-22-8-4-14(5-9-22)15-3-7-20-17(11-15)21-16-10-13(12-18)2-6-19-16/h2-3,6-7,10-11,14H,4-5,8-9H2,1H3,(H,19,20,21) |
| InChIKey | RPPMNQIBTJVABG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|