About 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine
2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 134293760) has the molecular formula C18H16N6O
and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine |
| PubChem CID | 134293760 |
| Molecular Formula | C18H16N6O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | C=Cc1nc(NCc2ncco2)c2c(ccn2Cc2ccccn2)n1 |
| InChI | InChI=1S/C18H16N6O/c1-2-15-22-14-6-9-24(12-13-5-3-4-7-19-13)17(14)18(23-15)21-11-16-20-8-10-25-16/h2-10H,1,11-12H2,(H,21,22,23) |
| InChIKey | JVLZRWXZTOKWCM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine?
The IUPAC name of 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine (CID 134293760) is 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine is C=Cc1nc(NCc2ncco2)c2c(ccn2Cc2ccccn2)n1.
What is the InChIKey of 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine?
The InChIKey is JVLZRWXZTOKWCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N6O/c1-2-15-22-14-6-9-24(12-13-5-3-4-7-19-13)17(14)18(23-15)21-11-16-20-8-10-25-16/h2-10H,1,11-12H2,(H,21,22,23).
What are the key properties of 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine?
2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine has a molecular weight of 332.37 g/mol, XLogP of 3.12, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-N-(1,3-oxazol-2-ylmethyl)-5-(pyridin-2-ylmethyl)pyrrolo[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 134293760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).