C17H29N — CID 134293805
(6E,8Z)-3-ethyl-6,7-dimethyl-N-prop-1-en-2-yldeca-6,8-dien-5-imine (PubChem CID 134293805) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is (6E,8Z)-3-ethyl-6,7-dimethyl-N-prop-1-en-2-yldeca-6,8-dien-5-imine.
| Compound Name | (6E,8Z)-3-ethyl-6,7-dimethyl-N-prop-1-en-2-yldeca-6,8-dien-5-imine |
|---|---|
| PubChem CID | 134293805 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | (6E,8Z)-3-ethyl-6,7-dimethyl-N-prop-1-en-2-yldeca-6,8-dien-5-imine |
| SMILES | C=C(C)/N=C(CC(CC)CC)/C(C)=C(C)/C=C\C |
| InChI | InChI=1S/C17H29N/c1-8-11-14(6)15(7)17(18-13(4)5)12-16(9-2)10-3/h8,11,16H,4,9-10,12H2,1-3,5-7H3/b11-8-,15-14+,18-17+ |
| InChIKey | SHJYEIFTWSMTOP-VETDLQQISA-N |
| XLogP | 5.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|