C7H4ClN5O2 — CID 134294572
1-(4-amino-6-chloro-1,3,5-triazin-2-yl)pyrrole-2,5-dione (PubChem CID 134294572) has the molecular formula C7H4ClN5O2 and a molecular weight of 225.59 g/mol. Its IUPAC name is 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)pyrrole-2,5-dione.
| Compound Name | 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 134294572 |
| Molecular Formula | C7H4ClN5O2 |
| Molecular Weight | 225.59 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)pyrrole-2,5-dione |
| SMILES | Nc1nc(Cl)nc(N2C(=O)C=CC2=O)n1 |
| InChI | InChI=1S/C7H4ClN5O2/c8-5-10-6(9)12-7(11-5)13-3(14)1-2-4(13)15/h1-2H,(H2,9,10,11,12) |
| InChIKey | HTDANAHFJWRNTM-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.59 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|