C12H14FNO4 — CID 134294948
[(1R,2S)-7-fluoro-1-(methoxymethoxy)-2,3-dihydro-1H-inden-2-yl] carbamate (PubChem CID 134294948) has the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. Its IUPAC name is [(1R,2S)-7-fluoro-1-(methoxymethoxy)-2,3-dihydro-1H-inden-2-yl] carbamate.
| Compound Name | [(1R,2S)-7-fluoro-1-(methoxymethoxy)-2,3-dihydro-1H-inden-2-yl] carbamate |
|---|---|
| PubChem CID | 134294948 |
| Molecular Formula | C12H14FNO4 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | [(1R,2S)-7-fluoro-1-(methoxymethoxy)-2,3-dihydro-1H-inden-2-yl] carbamate |
| SMILES | COCO[C@@H]1c2c(F)cccc2C[C@@H]1OC(N)=O |
| InChI | InChI=1S/C12H14FNO4/c1-16-6-17-11-9(18-12(14)15)5-7-3-2-4-8(13)10(7)11/h2-4,9,11H,5-6H2,1H3,(H2,14,15)/t9-,11-/m0/s1 |
| InChIKey | GJIWEINFVKMDJV-ONGXEEELSA-N |
| XLogP | 1.51 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|