C23H22N4O3 — CID 134295241
1-[3-[3-cyclobutyl-3-hydroxy-4-(methylamino)-4-oxobut-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide (PubChem CID 134295241) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 1-[3-[3-cyclobutyl-3-hydroxy-4-(methylamino)-4-oxobut-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 1-[3-[3-cyclobutyl-3-hydroxy-4-(methylamino)-4-oxobut-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134295241 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[3-[3-cyclobutyl-3-hydroxy-4-(methylamino)-4-oxobut-1-ynyl]phenyl]imidazo[1,5-a]pyridine-3-carboxamide |
| SMILES | CNC(=O)C(O)(C#Cc1cccc(-c2nc(C(N)=O)n3ccccc23)c1)C1CCC1 |
| InChI | InChI=1S/C23H22N4O3/c1-25-22(29)23(30,17-8-5-9-17)12-11-15-6-4-7-16(14-15)19-18-10-2-3-13-27(18)21(26-19)20(24)28/h2-4,6-7,10,13-14,17,30H,5,8-9H2,1H3,(H2,24,28)(H,25,29) |
| InChIKey | OKHFZUYHPJTIBL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|