C41H28F3N3O2 — CID 134295575
2,6-bis(2-methoxycarbazol-9-yl)-4-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 134295575) has the molecular formula C41H28F3N3O2 and a molecular weight of 651.69 g/mol. Its IUPAC name is 2,6-bis(2-methoxycarbazol-9-yl)-4-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,6-bis(2-methoxycarbazol-9-yl)-4-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 134295575 |
| Molecular Formula | C41H28F3N3O2 |
| Molecular Weight | 651.69 g/mol |
| Exact Mass | 651.21 |
| IUPAC Name | 2,6-bis(2-methoxycarbazol-9-yl)-4-[3-methyl-5-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | COc1ccc2c3ccccc3n(-c3cc(-c4cc(C)cc(C(F)(F)F)c4)cc(-n4c5ccccc5c5ccc(OC)cc54)c3C#N)c2c1 |
| InChI | InChI=1S/C41H28F3N3O2/c1-24-16-25(18-27(17-24)41(42,43)44)26-19-37(46-35-10-6-4-8-30(35)32-14-12-28(48-2)21-39(32)46)34(23-45)38(20-26)47-36-11-7-5-9-31(36)33-15-13-29(49-3)22-40(33)47/h4-22H,1-3H3 |
| InChIKey | SXIXDSLTDQTRNC-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 52.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.69 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |