About (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide
(E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide (PubChem CID 134295928) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide |
| PubChem CID | 134295928 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide |
| SMILES | CN(C)C(=O)/C=C/CNC(C)(C)C |
| InChI | InChI=1S/C10H20N2O/c1-10(2,3)11-8-6-7-9(13)12(4)5/h6-7,11H,8H2,1-5H3/b7-6+ |
| InChIKey | ZGOWZVQEVAQXGB-VOTSOKGWSA-N |
| XLogP | 1.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide?
The IUPAC name of (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide (CID 134295928) is (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide.
What is the SMILES notation for (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide?
The canonical SMILES for (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide is CN(C)C(=O)/C=C/CNC(C)(C)C.
What is the InChIKey of (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide?
The InChIKey is ZGOWZVQEVAQXGB-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H20N2O/c1-10(2,3)11-8-6-7-9(13)12(4)5/h6-7,11H,8H2,1-5H3/b7-6+.
What are the key properties of (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide?
(E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide has a molecular weight of 184.28 g/mol, XLogP of 1.02, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide is sourced from PubChem (CID 134295928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).