C10H20N2O — CID 134295928
(E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide (PubChem CID 134295928) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide.
| Compound Name | (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 134295928 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (E)-4-(tert-butylamino)-N,N-dimethylbut-2-enamide |
| SMILES | CN(C)C(=O)/C=C/CNC(C)(C)C |
| InChI | InChI=1S/C10H20N2O/c1-10(2,3)11-8-6-7-9(13)12(4)5/h6-7,11H,8H2,1-5H3/b7-6+ |
| InChIKey | ZGOWZVQEVAQXGB-VOTSOKGWSA-N |
| XLogP | 1.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|