C28H36F2N6O3 — CID 134296965
[7-tert-butyl-5-(4,4-difluorocyclohexyl)furo[3,2-b]pyridin-2-yl]-[2,2-dimethyl-4-(5-methyl-1H-1,2,4-triazole-3-carbonyl)piperazin-1-yl]methanone (PubChem CID 134296965) has the molecular formula C28H36F2N6O3 and a molecular weight of 542.63 g/mol. Its IUPAC name is [7-tert-butyl-5-(4,4-difluorocyclohexyl)furo[3,2-b]pyridin-2-yl]-[2,2-dimethyl-4-(5-methyl-1H-1,2,4-triazole-3-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [7-tert-butyl-5-(4,4-difluorocyclohexyl)furo[3,2-b]pyridin-2-yl]-[2,2-dimethyl-4-(5-methyl-1H-1,2,4-triazole-3-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 134296965 |
| Molecular Formula | C28H36F2N6O3 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | [7-tert-butyl-5-(4,4-difluorocyclohexyl)furo[3,2-b]pyridin-2-yl]-[2,2-dimethyl-4-(5-methyl-1H-1,2,4-triazole-3-carbonyl)piperazin-1-yl]methanone |
| SMILES | Cc1nc(C(=O)N2CCN(C(=O)c3cc4nc(C5CCC(F)(F)CC5)cc(C(C)(C)C)c4o3)C(C)(C)C2)n[nH]1 |
| InChI | InChI=1S/C28H36F2N6O3/c1-16-31-23(34-33-16)25(38)35-11-12-36(27(5,6)15-35)24(37)21-14-20-22(39-21)18(26(2,3)4)13-19(32-20)17-7-9-28(29,30)10-8-17/h13-14,17H,7-12,15H2,1-6H3,(H,31,33,34) |
| InChIKey | AKRJNNLHBJIWPD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |