About (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide
(3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide (PubChem CID 134297156) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide.
Molecular Properties
| Compound Name | (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide |
| PubChem CID | 134297156 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide |
| SMILES | C=C/C=C\C(=N/C=C)C(=O)NC |
| InChI | InChI=1S/C9H12N2O/c1-4-6-7-8(11-5-2)9(12)10-3/h4-7H,1-2H2,3H3,(H,10,12)/b7-6-,11-8+ |
| InChIKey | BMPNBQNVVZDRDH-BQGCWICQSA-N |
| XLogP | 1.06 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide?
The IUPAC name of (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide (CID 134297156) is (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide.
What is the SMILES notation for (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide?
The canonical SMILES for (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide is C=C/C=C\C(=N/C=C)C(=O)NC.
What is the InChIKey of (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide?
The InChIKey is BMPNBQNVVZDRDH-BQGCWICQSA-N. The full InChI is InChI=1S/C9H12N2O/c1-4-6-7-8(11-5-2)9(12)10-3/h4-7H,1-2H2,3H3,(H,10,12)/b7-6-,11-8+.
What are the key properties of (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide?
(3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide has a molecular weight of 164.21 g/mol, XLogP of 1.06, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-ethenylimino-N-methylhexa-3,5-dienamide is sourced from PubChem (CID 134297156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).