C38H56O2 — CID 134297768
2,7-bis(2,6,7,7-tetramethyloctan-2-yl)anthracene-9,10-dione (PubChem CID 134297768) has the molecular formula C38H56O2 and a molecular weight of 544.86 g/mol. Its IUPAC name is 2,7-bis(2,6,7,7-tetramethyloctan-2-yl)anthracene-9,10-dione.
| Compound Name | 2,7-bis(2,6,7,7-tetramethyloctan-2-yl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 134297768 |
| Molecular Formula | C38H56O2 |
| Molecular Weight | 544.86 g/mol |
| Exact Mass | 544.43 |
| IUPAC Name | 2,7-bis(2,6,7,7-tetramethyloctan-2-yl)anthracene-9,10-dione |
| SMILES | CC(CCCC(C)(C)c1ccc2c(c1)C(=O)c1cc(C(C)(C)CCCC(C)C(C)(C)C)ccc1C2=O)C(C)(C)C |
| InChI | InChI=1S/C38H56O2/c1-25(35(3,4)5)15-13-21-37(9,10)27-17-19-29-31(23-27)34(40)32-24-28(18-20-30(32)33(29)39)38(11,12)22-14-16-26(2)36(6,7)8/h17-20,23-26H,13-16,21-22H2,1-12H3 |
| InChIKey | PYCDZNDJZWYHQM-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.86 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|