About tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate
tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate (PubChem CID 134297972) has the molecular formula C24H30FNO2
and a molecular weight of 383.51 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate |
| PubChem CID | 134297972 |
| Molecular Formula | C24H30FNO2 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C[C@@H](C(c1ccccc1)c1ccccc1F)[C@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H30FNO2/c1-17(21-15-10-16-26(21)23(27)28-24(2,3)4)22(18-11-6-5-7-12-18)19-13-8-9-14-20(19)25/h5-9,11-14,17,21-22H,10,15-16H2,1-4H3/t17-,21-,22?/m1/s1 |
| InChIKey | SRDHHUJTBDBGAZ-WQHYPHNRSA-N |
| XLogP | 5.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate (CID 134297972) is tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate is C[C@@H](C(c1ccccc1)c1ccccc1F)[C@H]1CCCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate?
The InChIKey is SRDHHUJTBDBGAZ-WQHYPHNRSA-N. The full InChI is InChI=1S/C24H30FNO2/c1-17(21-15-10-16-26(21)23(27)28-24(2,3)4)22(18-11-6-5-7-12-18)19-13-8-9-14-20(19)25/h5-9,11-14,17,21-22H,10,15-16H2,1-4H3/t17-,21-,22?/m1/s1.
What are the key properties of tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate?
tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate has a molecular weight of 383.51 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-2-[(1S,2S)-1-(2-fluorophenyl)-1-phenylpropan-2-yl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 134297972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).