About 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine
2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine (PubChem CID 134298147) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine.
Molecular Properties
| Compound Name | 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine |
| PubChem CID | 134298147 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine |
| SMILES | CCCC1CCC2C3CC(CC3CCN)C12 |
| InChI | InChI=1S/C15H27N/c1-2-3-10-4-5-13-14-9-12(15(10)13)8-11(14)6-7-16/h10-15H,2-9,16H2,1H3 |
| InChIKey | YGHMELVDMRKMSB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine?
The IUPAC name of 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine (CID 134298147) is 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine.
What is the SMILES notation for 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine?
The canonical SMILES for 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine is CCCC1CCC2C3CC(CC3CCN)C12.
What is the InChIKey of 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine?
The InChIKey is YGHMELVDMRKMSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N/c1-2-3-10-4-5-13-14-9-12(15(10)13)8-11(14)6-7-16/h10-15H,2-9,16H2,1H3.
What are the key properties of 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine?
2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine has a molecular weight of 221.39 g/mol, XLogP of 3.43, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-propyl-8-tricyclo[5.2.1.02,6]decanyl)ethanamine is sourced from PubChem (CID 134298147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).