C28H46N2 — CID 134299320
1-N'-[(2E,4E)-4-tert-butyl-8-methylideneundeca-2,4-dien-2-yl]-1-N-[(1E,3Z,5Z)-5-methylhepta-1,3,5-trienyl]but-2-ene-1,1-diamine (PubChem CID 134299320) has the molecular formula C28H46N2 and a molecular weight of 410.69 g/mol. Its IUPAC name is 1-N'-[(2E,4E)-4-tert-butyl-8-methylideneundeca-2,4-dien-2-yl]-1-N-[(1E,3Z,5Z)-5-methylhepta-1,3,5-trienyl]but-2-ene-1,1-diamine.
| Compound Name | 1-N'-[(2E,4E)-4-tert-butyl-8-methylideneundeca-2,4-dien-2-yl]-1-N-[(1E,3Z,5Z)-5-methylhepta-1,3,5-trienyl]but-2-ene-1,1-diamine |
|---|---|
| PubChem CID | 134299320 |
| Molecular Formula | C28H46N2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.37 |
| IUPAC Name | 1-N'-[(2E,4E)-4-tert-butyl-8-methylideneundeca-2,4-dien-2-yl]-1-N-[(1E,3Z,5Z)-5-methylhepta-1,3,5-trienyl]but-2-ene-1,1-diamine |
| SMILES | C=C(CCC)CC/C=C(\C=C(/C)NC(C=CC)N/C=C/C=C\C(C)=C/C)C(C)(C)C |
| InChI | InChI=1S/C28H46N2/c1-10-16-24(5)19-15-20-26(28(7,8)9)22-25(6)30-27(17-11-2)29-21-14-13-18-23(4)12-3/h11-14,17-18,20-22,27,29-30H,5,10,15-16,19H2,1-4,6-9H3/b17-11?,18-13-,21-14+,23-12-,25-22+,26-20+ |
| InChIKey | BRPOERGEDKFGRN-YZTARYJGSA-N |
| XLogP | 8.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|