About N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide
N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide (PubChem CID 134299489) has the molecular formula C10H21N3
and a molecular weight of 183.30 g/mol. Its IUPAC name is N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide.
Molecular Properties
| Compound Name | N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide |
| PubChem CID | 134299489 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide |
| SMILES | CCC/C(N)=N\C=C(/N)C(C)(C)C |
| InChI | InChI=1S/C10H21N3/c1-5-6-9(12)13-7-8(11)10(2,3)4/h7H,5-6,11H2,1-4H3,(H2,12,13)/b8-7- |
| InChIKey | RWYXXDRWVFNFCC-FPLPWBNLSA-N |
| XLogP | 1.99 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide?
The IUPAC name of N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide (CID 134299489) is N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide.
What is the SMILES notation for N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide?
The canonical SMILES for N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide is CCC/C(N)=N\C=C(/N)C(C)(C)C.
What is the InChIKey of N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide?
The InChIKey is RWYXXDRWVFNFCC-FPLPWBNLSA-N. The full InChI is InChI=1S/C10H21N3/c1-5-6-9(12)13-7-8(11)10(2,3)4/h7H,5-6,11H2,1-4H3,(H2,12,13)/b8-7-.
What are the key properties of N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide?
N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide has a molecular weight of 183.30 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-2-amino-3,3-dimethylbut-1-enyl]butanimidamide is sourced from PubChem (CID 134299489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).