C59H37N3S — CID 134299574
2-phenyl-4-(4-phenylphenyl)-6-[3-[3-[3-(21-thiapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15,17,19-decaen-16-yl)phenyl]phenyl]phenyl]-1,3,5-triazine (PubChem CID 134299574) has the molecular formula C59H37N3S and a molecular weight of 820.03 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-[3-[3-[3-(21-thiapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15,17,19-decaen-16-yl)phenyl]phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-[3-[3-[3-(21-thiapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15,17,19-decaen-16-yl)phenyl]phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 134299574 |
| Molecular Formula | C59H37N3S |
| Molecular Weight | 820.03 g/mol |
| Exact Mass | 819.27 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-[3-[3-[3-(21-thiapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15,17,19-decaen-16-yl)phenyl]phenyl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5cccc(-c6cccc(-c7cccc8sc9c%10ccccc%10c%10ccccc%10c9c78)c6)c5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C59H37N3S/c1-3-15-38(16-4-1)39-31-33-41(34-32-39)58-60-57(40-17-5-2-6-18-40)61-59(62-58)47-24-13-22-45(37-47)43-20-11-19-42(35-43)44-21-12-23-46(36-44)48-29-14-30-53-54(48)55-51-27-9-7-25-49(51)50-26-8-10-28-52(50)56(55)63-53/h1-37H |
| InChIKey | MIZRECBVRKVTGV-UHFFFAOYSA-N |
| XLogP | 16.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.03 |
| LogP ≤ 5 | 16.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|