C61H39N3O — CID 134299618
2-[3-[3-(3-naphtho[2,3-b][1]benzofuran-1-ylphenyl)phenyl]phenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine (PubChem CID 134299618) has the molecular formula C61H39N3O and a molecular weight of 830.00 g/mol. Its IUPAC name is 2-[3-[3-(3-naphtho[2,3-b][1]benzofuran-1-ylphenyl)phenyl]phenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-[3-(3-naphtho[2,3-b][1]benzofuran-1-ylphenyl)phenyl]phenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 134299618 |
| Molecular Formula | C61H39N3O |
| Molecular Weight | 830.00 g/mol |
| Exact Mass | 829.31 |
| IUPAC Name | 2-[3-[3-(3-naphtho[2,3-b][1]benzofuran-1-ylphenyl)phenyl]phenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4cccc(-c5ccccc5)c4)nc(-c4cccc(-c5cccc(-c6cccc(-c7cccc8oc9cc%10ccccc%10cc9c78)c6)c5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C61H39N3O/c1-3-15-40(16-4-1)42-21-11-28-51(35-42)59-62-60(52-29-12-22-43(36-52)41-17-5-2-6-18-41)64-61(63-59)53-30-13-26-47(37-53)45-24-9-23-44(33-45)46-25-10-27-50(34-46)54-31-14-32-56-58(54)55-38-48-19-7-8-20-49(48)39-57(55)65-56/h1-39H |
| InChIKey | LMILIGLQAOSYRK-UHFFFAOYSA-N |
| XLogP | 16.26 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.00 |
| LogP ≤ 5 | 16.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |