About (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one
(4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one (PubChem CID 134299954) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one.
Molecular Properties
| Compound Name | (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one |
| PubChem CID | 134299954 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one |
| SMILES | C/C=c1/ncoc(=O)/c1=C/C |
| InChI | InChI=1S/C8H9NO2/c1-3-6-7(4-2)9-5-11-8(6)10/h3-5H,1-2H3/b6-3+,7-4+ |
| InChIKey | BMQHBHYIHUVRQO-XOKGJFMYSA-N |
| XLogP | -0.36 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one?
The IUPAC name of (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one (CID 134299954) is (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one.
What is the SMILES notation for (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one?
The canonical SMILES for (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one is C/C=c1/ncoc(=O)/c1=C/C.
What is the InChIKey of (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one?
The InChIKey is BMQHBHYIHUVRQO-XOKGJFMYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-3-6-7(4-2)9-5-11-8(6)10/h3-5H,1-2H3/b6-3+,7-4+.
What are the key properties of (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one?
(4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one has a molecular weight of 151.16 g/mol, XLogP of -0.36, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-4,5-di(ethylidene)-1,3-oxazin-6-one is sourced from PubChem (CID 134299954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).