C19H16N2O — CID 134300418
13-ethyl-12-[(Z)-prop-1-enyl]-11,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),6,8,10,12-heptaen-15-one (PubChem CID 134300418) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is 13-ethyl-12-[(Z)-prop-1-enyl]-11,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),6,8,10,12-heptaen-15-one.
| Compound Name | 13-ethyl-12-[(Z)-prop-1-enyl]-11,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),6,8,10,12-heptaen-15-one |
|---|---|
| PubChem CID | 134300418 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 13-ethyl-12-[(Z)-prop-1-enyl]-11,14-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),6,8,10,12-heptaen-15-one |
| SMILES | C/C=C\c1nc2c3cccc4cccc(c(=O)n2c1CC)c43 |
| InChI | InChI=1S/C19H16N2O/c1-3-7-15-16(4-2)21-18(20-15)13-10-5-8-12-9-6-11-14(17(12)13)19(21)22/h3,5-11H,4H2,1-2H3/b7-3- |
| InChIKey | DTCZLZYZXOYCCQ-CLTKARDFSA-N |
| XLogP | 4.03 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |