C13H17N — CID 134301487
(1Z,3Z)-N-ethyl-4-ethynyl-N-methyl-5-methylidenehepta-1,3,6-trien-1-amine (PubChem CID 134301487) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (1Z,3Z)-N-ethyl-4-ethynyl-N-methyl-5-methylidenehepta-1,3,6-trien-1-amine.
| Compound Name | (1Z,3Z)-N-ethyl-4-ethynyl-N-methyl-5-methylidenehepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 134301487 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (1Z,3Z)-N-ethyl-4-ethynyl-N-methyl-5-methylidenehepta-1,3,6-trien-1-amine |
| SMILES | C#C/C(=C/C=C\N(C)CC)C(=C)C=C |
| InChI | InChI=1S/C13H17N/c1-6-12(4)13(7-2)10-9-11-14(5)8-3/h2,6,9-11H,1,4,8H2,3,5H3/b11-9-,13-10- |
| InChIKey | BCPZEELPLROZAC-VYXXYXFFSA-N |
| XLogP | 2.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|