C13H23N3 — CID 134301576
(3E,5Z)-N-[(Z)-2-[amino(methyl)amino]prop-1-enyl]-5-ethylhepta-1,3,5-trien-4-amine (PubChem CID 134301576) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is (3E,5Z)-N-[(Z)-2-[amino(methyl)amino]prop-1-enyl]-5-ethylhepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-N-[(Z)-2-[amino(methyl)amino]prop-1-enyl]-5-ethylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 134301576 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | (3E,5Z)-N-[(Z)-2-[amino(methyl)amino]prop-1-enyl]-5-ethylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(N/C=C(/C)N(C)N)\C(=C/C)CC |
| InChI | InChI=1S/C13H23N3/c1-6-9-13(12(7-2)8-3)15-10-11(4)16(5)14/h6-7,9-10,15H,1,8,14H2,2-5H3/b11-10-,12-7-,13-9+ |
| InChIKey | FXEKIPBZIRRDQC-YYAOGLGRSA-N |
| XLogP | 2.67 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|