About 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole
2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole (PubChem CID 134301627) has the molecular formula C20H20FNS
and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole |
| PubChem CID | 134301627 |
| Molecular Formula | C20H20FNS |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole |
| SMILES | C=C(CCC)c1cnc(-c2cc(C)c3c(C)ccc(F)c3c2)s1 |
| InChI | InChI=1S/C20H20FNS/c1-5-6-12(2)18-11-22-20(23-18)15-9-14(4)19-13(3)7-8-17(21)16(19)10-15/h7-11H,2,5-6H2,1,3-4H3 |
| InChIKey | UOPUKIATRGIULT-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole?
The IUPAC name of 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole (CID 134301627) is 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole.
What is the SMILES notation for 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole?
The canonical SMILES for 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole is C=C(CCC)c1cnc(-c2cc(C)c3c(C)ccc(F)c3c2)s1.
What is the InChIKey of 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole?
The InChIKey is UOPUKIATRGIULT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FNS/c1-5-6-12(2)18-11-22-20(23-18)15-9-14(4)19-13(3)7-8-17(21)16(19)10-15/h7-11H,2,5-6H2,1,3-4H3.
What are the key properties of 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole?
2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole has a molecular weight of 325.45 g/mol, XLogP of 6.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-fluoro-4,5-dimethylnaphthalen-2-yl)-5-pent-1-en-2-yl-1,3-thiazole is sourced from PubChem (CID 134301627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).