C21H22FN5O3S — CID 134301665
(1R,3R)-3-[2-fluoro-5-[3-(5-methoxypyrimidin-2-yl)-1,2-oxazol-5-yl]phenyl]-3,6,6-trimethyl-1-oxo-2H-1,4-thiazin-5-amine (PubChem CID 134301665) has the molecular formula C21H22FN5O3S and a molecular weight of 443.50 g/mol. Its IUPAC name is (1R,3R)-3-[2-fluoro-5-[3-(5-methoxypyrimidin-2-yl)-1,2-oxazol-5-yl]phenyl]-3,6,6-trimethyl-1-oxo-2H-1,4-thiazin-5-amine.
| Compound Name | (1R,3R)-3-[2-fluoro-5-[3-(5-methoxypyrimidin-2-yl)-1,2-oxazol-5-yl]phenyl]-3,6,6-trimethyl-1-oxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 134301665 |
| Molecular Formula | C21H22FN5O3S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (1R,3R)-3-[2-fluoro-5-[3-(5-methoxypyrimidin-2-yl)-1,2-oxazol-5-yl]phenyl]-3,6,6-trimethyl-1-oxo-2H-1,4-thiazin-5-amine |
| SMILES | COc1cnc(-c2cc(-c3ccc(F)c([C@]4(C)C[S@@](=O)C(C)(C)C(N)=N4)c3)on2)nc1 |
| InChI | InChI=1S/C21H22FN5O3S/c1-20(2)19(23)26-21(3,11-31(20)28)14-7-12(5-6-15(14)22)17-8-16(27-30-17)18-24-9-13(29-4)10-25-18/h5-10H,11H2,1-4H3,(H2,23,26)/t21-,31+/m0/s1 |
| InChIKey | DHHAZEPCAMHKLR-JCOAXYOVSA-N |
| XLogP | 3.06 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |