About N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline
N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline (PubChem CID 134301730) has the molecular formula C23H27N
and a molecular weight of 317.48 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline.
Molecular Properties
| Compound Name | N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline |
| PubChem CID | 134301730 |
| Molecular Formula | C23H27N |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline |
| SMILES | C=CC(=C)C(=C)N(c1ccc(C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H27N/c1-8-18(3)19(4)24(21-13-9-17(2)10-14-21)22-15-11-20(12-16-22)23(5,6)7/h8-16H,1,3-4H2,2,5-7H3 |
| InChIKey | XDQJILWXXOMKTL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline?
The IUPAC name of N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline (CID 134301730) is N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline.
What is the SMILES notation for N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline?
The canonical SMILES for N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline is C=CC(=C)C(=C)N(c1ccc(C)cc1)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline?
The InChIKey is XDQJILWXXOMKTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N/c1-8-18(3)19(4)24(21-13-9-17(2)10-14-21)22-15-11-20(12-16-22)23(5,6)7/h8-16H,1,3-4H2,2,5-7H3.
What are the key properties of N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline?
N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline has a molecular weight of 317.48 g/mol, XLogP of 6.69, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butylphenyl)-4-methyl-N-(3-methylidenepenta-1,4-dien-2-yl)aniline is sourced from PubChem (CID 134301730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).