C27H34F2N6O3 — CID 134301943
[7-tert-butyl-5-(4,4-difluorocyclohexyl)furo[3,2-b]pyridin-2-yl]-[2,2-dimethyl-4-(1H-1,2,4-triazole-5-carbonyl)piperazin-1-yl]methanone (PubChem CID 134301943) has the molecular formula C27H34F2N6O3 and a molecular weight of 528.60 g/mol. Its IUPAC name is [7-tert-butyl-5-(4,4-difluorocyclohexyl)furo[3,2-b]pyridin-2-yl]-[2,2-dimethyl-4-(1H-1,2,4-triazole-5-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [7-tert-butyl-5-(4,4-difluorocyclohexyl)furo[3,2-b]pyridin-2-yl]-[2,2-dimethyl-4-(1H-1,2,4-triazole-5-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 134301943 |
| Molecular Formula | C27H34F2N6O3 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | [7-tert-butyl-5-(4,4-difluorocyclohexyl)furo[3,2-b]pyridin-2-yl]-[2,2-dimethyl-4-(1H-1,2,4-triazole-5-carbonyl)piperazin-1-yl]methanone |
| SMILES | CC(C)(C)c1cc(C2CCC(F)(F)CC2)nc2cc(C(=O)N3CCN(C(=O)c4ncn[nH]4)CC3(C)C)oc12 |
| InChI | InChI=1S/C27H34F2N6O3/c1-25(2,3)17-12-18(16-6-8-27(28,29)9-7-16)32-19-13-20(38-21(17)19)23(36)35-11-10-34(14-26(35,4)5)24(37)22-30-15-31-33-22/h12-13,15-16H,6-11,14H2,1-5H3,(H,30,31,33) |
| InChIKey | IUBIEMJSRUMDHL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |