C10H14O — CID 134302749
1,2,4,5,8,9-hexahydro-3-benzoxepine (PubChem CID 134302749) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 1,2,4,5,8,9-hexahydro-3-benzoxepine.
| Compound Name | 1,2,4,5,8,9-hexahydro-3-benzoxepine |
|---|---|
| PubChem CID | 134302749 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 1,2,4,5,8,9-hexahydro-3-benzoxepine |
| SMILES | C1=CC2=C(CC1)CCOCC2 |
| InChI | InChI=1S/C10H14O/c1-2-4-10-6-8-11-7-5-9(10)3-1/h1,3H,2,4-8H2 |
| InChIKey | XRDUSCIIPXIITL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |