C18H16FN5O5 — CID 134302852
triazolo[4,5-b]pyridin-3-yl (6R)-1-(2-ethoxy-2-oxoacetyl)-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate (PubChem CID 134302852) has the molecular formula C18H16FN5O5 and a molecular weight of 401.35 g/mol. Its IUPAC name is triazolo[4,5-b]pyridin-3-yl (6R)-1-(2-ethoxy-2-oxoacetyl)-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate.
| Compound Name | triazolo[4,5-b]pyridin-3-yl (6R)-1-(2-ethoxy-2-oxoacetyl)-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate |
|---|---|
| PubChem CID | 134302852 |
| Molecular Formula | C18H16FN5O5 |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | triazolo[4,5-b]pyridin-3-yl (6R)-1-(2-ethoxy-2-oxoacetyl)-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate |
| SMILES | CCOC(=O)C(=O)c1c(C)c(C(=O)On2nnc3cccnc32)n2c1C[C@@H](F)C2 |
| InChI | InChI=1S/C18H16FN5O5/c1-3-28-18(27)15(25)13-9(2)14(23-8-10(19)7-12(13)23)17(26)29-24-16-11(21-22-24)5-4-6-20-16/h4-6,10H,3,7-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | RTTHXZZEIURWKD-SNVBAGLBSA-N |
| XLogP | 0.85 |
| TPSA | 118.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|