C22H19F3N6O4 — CID 134302938
[(3-diazenyl-2-pyridinyl)amino] (6R)-1-[2-[(1-ethynyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate (PubChem CID 134302938) has the molecular formula C22H19F3N6O4 and a molecular weight of 488.43 g/mol. Its IUPAC name is [(3-diazenyl-2-pyridinyl)amino] (6R)-1-[2-[(1-ethynyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate.
| Compound Name | [(3-diazenyl-2-pyridinyl)amino] (6R)-1-[2-[(1-ethynyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate |
|---|---|
| PubChem CID | 134302938 |
| Molecular Formula | C22H19F3N6O4 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [(3-diazenyl-2-pyridinyl)amino] (6R)-1-[2-[(1-ethynyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-6-fluoro-2-methyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate |
| SMILES | [H]/N=N\c1cccnc1NOC(=O)c1c(C)c(C(=O)C(=O)NC2(C#C)CC(F)(F)C2)c2n1C[C@H](F)C2 |
| InChI | InChI=1S/C22H19F3N6O4/c1-3-21(9-22(24,25)10-21)28-19(33)17(32)15-11(2)16(31-8-12(23)7-14(15)31)20(34)35-30-18-13(29-26)5-4-6-27-18/h1,4-6,12,26H,7-10H2,2H3,(H,27,30)(H,28,33)/b29-26-/t12-/m1/s1 |
| InChIKey | JICRZTDYTLVVIY-UKJNEWNMSA-N |
| XLogP | 3.03 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|