About [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate
[(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate (PubChem CID 134303724) has the molecular formula C19H17F2NO2
and a molecular weight of 329.35 g/mol. Its IUPAC name is [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate.
Molecular Properties
| Compound Name | [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate |
| PubChem CID | 134303724 |
| Molecular Formula | C19H17F2NO2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate |
| SMILES | O=C(ON1CCC[C@@H]1/C=C/c1cccc(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C19H17F2NO2/c20-17-10-4-8-14(18(17)21)11-12-16-9-5-13-22(16)24-19(23)15-6-2-1-3-7-15/h1-4,6-8,10-12,16H,5,9,13H2/b12-11+/t16-/m1/s1 |
| InChIKey | MJTUKRBLCGTPTB-LPQFERQCSA-N |
| XLogP | 4.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate?
The IUPAC name of [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate (CID 134303724) is [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate.
What is the SMILES notation for [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate?
The canonical SMILES for [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate is O=C(ON1CCC[C@@H]1/C=C/c1cccc(F)c1F)c1ccccc1.
What is the InChIKey of [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate?
The InChIKey is MJTUKRBLCGTPTB-LPQFERQCSA-N. The full InChI is InChI=1S/C19H17F2NO2/c20-17-10-4-8-14(18(17)21)11-12-16-9-5-13-22(16)24-19(23)15-6-2-1-3-7-15/h1-4,6-8,10-12,16H,5,9,13H2/b12-11+/t16-/m1/s1.
What are the key properties of [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate?
[(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate has a molecular weight of 329.35 g/mol, XLogP of 4.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-[(E)-2-(2,3-difluorophenyl)ethenyl]pyrrolidin-1-yl] benzoate is sourced from PubChem (CID 134303724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).