C33H39N3O3 — CID 134304077
3-[[4-[1-[5-(4-tert-butylphenyl)indazol-1-yl]-4-methylpentyl]benzoyl]amino]propanoic acid (PubChem CID 134304077) has the molecular formula C33H39N3O3 and a molecular weight of 525.69 g/mol. Its IUPAC name is 3-[[4-[1-[5-(4-tert-butylphenyl)indazol-1-yl]-4-methylpentyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-[5-(4-tert-butylphenyl)indazol-1-yl]-4-methylpentyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 134304077 |
| Molecular Formula | C33H39N3O3 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 3-[[4-[1-[5-(4-tert-butylphenyl)indazol-1-yl]-4-methylpentyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)CCC(c1ccc(C(=O)NCCC(=O)O)cc1)n1ncc2cc(-c3ccc(C(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C33H39N3O3/c1-22(2)6-16-29(24-7-9-25(10-8-24)32(39)34-19-18-31(37)38)36-30-17-13-26(20-27(30)21-35-36)23-11-14-28(15-12-23)33(3,4)5/h7-15,17,20-22,29H,6,16,18-19H2,1-5H3,(H,34,39)(H,37,38) |
| InChIKey | TWFKFZNQRRVXJA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |