C28H25ClF3NO2 — CID 134304827
methyl 4-[1-[5-[2-chloro-4-(trifluoromethyl)phenyl]indol-1-yl]-3-methylbutyl]benzoate (PubChem CID 134304827) has the molecular formula C28H25ClF3NO2 and a molecular weight of 499.96 g/mol. Its IUPAC name is methyl 4-[1-[5-[2-chloro-4-(trifluoromethyl)phenyl]indol-1-yl]-3-methylbutyl]benzoate.
| Compound Name | methyl 4-[1-[5-[2-chloro-4-(trifluoromethyl)phenyl]indol-1-yl]-3-methylbutyl]benzoate |
|---|---|
| PubChem CID | 134304827 |
| Molecular Formula | C28H25ClF3NO2 |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | methyl 4-[1-[5-[2-chloro-4-(trifluoromethyl)phenyl]indol-1-yl]-3-methylbutyl]benzoate |
| SMILES | COC(=O)c1ccc(C(CC(C)C)n2ccc3cc(-c4ccc(C(F)(F)F)cc4Cl)ccc32)cc1 |
| InChI | InChI=1S/C28H25ClF3NO2/c1-17(2)14-26(18-4-6-19(7-5-18)27(34)35-3)33-13-12-21-15-20(8-11-25(21)33)23-10-9-22(16-24(23)29)28(30,31)32/h4-13,15-17,26H,14H2,1-3H3 |
| InChIKey | CGLYNBLZURLOCK-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |